C26H27N3O3S — CID 2856387
hexyl 4-[[(E)-2-cyano-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate (PubChem CID 2856387) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is hexyl 4-[[(E)-2-cyano-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate.
| Compound Name | hexyl 4-[[(E)-2-cyano-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate |
|---|---|
| PubChem CID | 2856387 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | hexyl 4-[[(E)-2-cyano-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate |
| SMILES | CCCCCCOC(=O)c1ccc(N/C=C(\C#N)c2nc(-c3ccc(OC)cc3)cs2)cc1 |
| InChI | InChI=1S/C26H27N3O3S/c1-3-4-5-6-15-32-26(30)20-7-11-22(12-8-20)28-17-21(16-27)25-29-24(18-33-25)19-9-13-23(31-2)14-10-19/h7-14,17-18,28H,3-6,15H2,1-2H3/b21-17+ |
| InChIKey | KMZPNVJRNUJDMO-HEHNFIMWSA-N |
| XLogP | 6.53 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|