C24H23N3O3S — CID 45029933
2-methylpropyl 4-[[(E)-2-cyano-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate (PubChem CID 45029933) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is 2-methylpropyl 4-[[(E)-2-cyano-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate.
| Compound Name | 2-methylpropyl 4-[[(E)-2-cyano-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate |
|---|---|
| PubChem CID | 45029933 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-methylpropyl 4-[[(E)-2-cyano-2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethenyl]amino]benzoate |
| SMILES | COc1ccc(-c2csc(/C(C#N)=C/Nc3ccc(C(=O)OCC(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C24H23N3O3S/c1-16(2)14-30-24(28)18-4-8-20(9-5-18)26-13-19(12-25)23-27-22(15-31-23)17-6-10-21(29-3)11-7-17/h4-11,13,15-16,26H,14H2,1-3H3/b19-13+ |
| InChIKey | WSVDSJGKWGFSQN-CPNJWEJPSA-N |
| XLogP | 5.61 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|