C24H22N2O2S — CID 7461331
methyl 4-[(Z)-2-cyano-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]ethenyl]benzoate (PubChem CID 7461331) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is methyl 4-[(Z)-2-cyano-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]ethenyl]benzoate.
| Compound Name | methyl 4-[(Z)-2-cyano-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]ethenyl]benzoate |
|---|---|
| PubChem CID | 7461331 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | methyl 4-[(Z)-2-cyano-2-[4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]ethenyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(/C#N)c2nc(-c3ccc(CC(C)C)cc3)cs2)cc1 |
| InChI | InChI=1S/C24H22N2O2S/c1-16(2)12-17-4-8-19(9-5-17)22-15-29-23(26-22)21(14-25)13-18-6-10-20(11-7-18)24(27)28-3/h4-11,13,15-16H,12H2,1-3H3/b21-13- |
| InChIKey | GDRCQDZUZJABSG-BKUYFWCQSA-N |
| XLogP | 5.86 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|