C22H18ClN3O4S — CID 3523867
methyl 2-[[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]-4,5-dimethoxybenzoate (PubChem CID 3523867) has the molecular formula C22H18ClN3O4S and a molecular weight of 455.92 g/mol. Its IUPAC name is methyl 2-[[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 3523867 |
| Molecular Formula | C22H18ClN3O4S |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | methyl 2-[[2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]amino]-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NC=C(C#N)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C22H18ClN3O4S/c1-28-19-8-16(22(27)30-3)17(9-20(19)29-2)25-11-14(10-24)21-26-18(12-31-21)13-4-6-15(23)7-5-13/h4-9,11-12,25H,1-3H3 |
| InChIKey | BKTPCIKMQBVFQM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|