C20H16ClN3O2S — CID 3687208
3-(4-chloro-2,5-dimethoxyanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 3687208) has the molecular formula C20H16ClN3O2S and a molecular weight of 397.89 g/mol. Its IUPAC name is 3-(4-chloro-2,5-dimethoxyanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-(4-chloro-2,5-dimethoxyanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3687208 |
| Molecular Formula | C20H16ClN3O2S |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 3-(4-chloro-2,5-dimethoxyanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | COc1cc(NC=C(C#N)c2nc(-c3ccccc3)cs2)c(OC)cc1Cl |
| InChI | InChI=1S/C20H16ClN3O2S/c1-25-18-9-16(19(26-2)8-15(18)21)23-11-14(10-22)20-24-17(12-27-20)13-6-4-3-5-7-13/h3-9,11-12,23H,1-2H3 |
| InChIKey | CBCQKKWLAGUASP-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|