C25H16ClN3O2S — CID 6294150
(E)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[(2-methoxydibenzofuran-3-yl)amino]prop-2-enenitrile (PubChem CID 6294150) has the molecular formula C25H16ClN3O2S and a molecular weight of 457.94 g/mol. Its IUPAC name is (E)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[(2-methoxydibenzofuran-3-yl)amino]prop-2-enenitrile.
| Compound Name | (E)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[(2-methoxydibenzofuran-3-yl)amino]prop-2-enenitrile |
|---|---|
| PubChem CID | 6294150 |
| Molecular Formula | C25H16ClN3O2S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | (E)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[(2-methoxydibenzofuran-3-yl)amino]prop-2-enenitrile |
| SMILES | COc1cc2c(cc1N/C=C(\C#N)c1nc(-c3ccc(Cl)cc3)cs1)oc1ccccc12 |
| InChI | InChI=1S/C25H16ClN3O2S/c1-30-24-10-19-18-4-2-3-5-22(18)31-23(19)11-20(24)28-13-16(12-27)25-29-21(14-32-25)15-6-8-17(26)9-7-15/h2-11,13-14,28H,1H3/b16-13+ |
| InChIKey | YWONQVWJUKIMCJ-DTQAZKPQSA-N |
| XLogP | 7.35 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|