C19H14ClN3O2S — CID 2856361
(E)-3-(2-chloroanilino)-2-[4-(4-hydroxy-3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 2856361) has the molecular formula C19H14ClN3O2S and a molecular weight of 383.86 g/mol. Its IUPAC name is (E)-3-(2-chloroanilino)-2-[4-(4-hydroxy-3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(2-chloroanilino)-2-[4-(4-hydroxy-3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2856361 |
| Molecular Formula | C19H14ClN3O2S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | (E)-3-(2-chloroanilino)-2-[4-(4-hydroxy-3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | COc1cc(-c2csc(/C(C#N)=C/Nc3ccccc3Cl)n2)ccc1O |
| InChI | InChI=1S/C19H14ClN3O2S/c1-25-18-8-12(6-7-17(18)24)16-11-26-19(23-16)13(9-21)10-22-15-5-3-2-4-14(15)20/h2-8,10-11,22,24H,1H3/b13-10+ |
| InChIKey | BJTMHIQNBZGQFM-JLHYYAGUSA-N |
| XLogP | 5.15 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|