C21H17F2N3O3S — CID 1415860
3-[2-(difluoromethoxy)anilino]-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 1415860) has the molecular formula C21H17F2N3O3S and a molecular weight of 429.45 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)anilino]-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-[2-(difluoromethoxy)anilino]-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 1415860 |
| Molecular Formula | C21H17F2N3O3S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 3-[2-(difluoromethoxy)anilino]-2-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | COc1ccc(-c2csc(C(C#N)=CNc3ccccc3OC(F)F)n2)cc1OC |
| InChI | InChI=1S/C21H17F2N3O3S/c1-27-18-8-7-13(9-19(18)28-2)16-12-30-20(26-16)14(10-24)11-25-15-5-3-4-6-17(15)29-21(22)23/h3-9,11-12,21,25H,1-2H3 |
| InChIKey | UVBJOEHCRZRXOS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|