C21H17F2N3OS — CID 1417260
3-[2-(difluoromethoxy)anilino]-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 1417260) has the molecular formula C21H17F2N3OS and a molecular weight of 397.45 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)anilino]-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-[2-(difluoromethoxy)anilino]-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 1417260 |
| Molecular Formula | C21H17F2N3OS |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 3-[2-(difluoromethoxy)anilino]-2-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | Cc1ccc(-c2csc(C(C#N)=CNc3ccccc3OC(F)F)n2)cc1C |
| InChI | InChI=1S/C21H17F2N3OS/c1-13-7-8-15(9-14(13)2)18-12-28-20(26-18)16(10-24)11-25-17-5-3-4-6-19(17)27-21(22)23/h3-9,11-12,21,25H,1-2H3 |
| InChIKey | AKTAUUOKTYOZJA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|