C18H11BrClN3S — CID 2856364
(E)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-(2-chloroanilino)prop-2-enenitrile (PubChem CID 2856364) has the molecular formula C18H11BrClN3S and a molecular weight of 416.73 g/mol. Its IUPAC name is (E)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-(2-chloroanilino)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-(2-chloroanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 2856364 |
| Molecular Formula | C18H11BrClN3S |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 414.95 |
| IUPAC Name | (E)-2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-(2-chloroanilino)prop-2-enenitrile |
| SMILES | N#C/C(=C\Nc1ccccc1Cl)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C18H11BrClN3S/c19-14-7-5-12(6-8-14)17-11-24-18(23-17)13(9-21)10-22-16-4-2-1-3-15(16)20/h1-8,10-11,22H/b13-10+ |
| InChIKey | HUGRLSQSZGIEMN-JLHYYAGUSA-N |
| XLogP | 6.20 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|