C22H15ClN4S — CID 1417741
(E)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[(2-methylquinolin-8-yl)amino]prop-2-enenitrile (PubChem CID 1417741) has the molecular formula C22H15ClN4S and a molecular weight of 402.91 g/mol. Its IUPAC name is (E)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[(2-methylquinolin-8-yl)amino]prop-2-enenitrile.
| Compound Name | (E)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[(2-methylquinolin-8-yl)amino]prop-2-enenitrile |
|---|---|
| PubChem CID | 1417741 |
| Molecular Formula | C22H15ClN4S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | (E)-2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[(2-methylquinolin-8-yl)amino]prop-2-enenitrile |
| SMILES | Cc1ccc2cccc(N/C=C(\C#N)c3nc(-c4ccc(Cl)cc4)cs3)c2n1 |
| InChI | InChI=1S/C22H15ClN4S/c1-14-5-6-16-3-2-4-19(21(16)26-14)25-12-17(11-24)22-27-20(13-28-22)15-7-9-18(23)10-8-15/h2-10,12-13,25H,1H3/b17-12+ |
| InChIKey | BCWWJURNDFWAIJ-SFQUDFHCSA-N |
| XLogP | 6.30 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|