C22H19N3O3S — CID 1390446
(E)-3-(2-acetyl-4,5-dimethoxyanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile (PubChem CID 1390446) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is (E)-3-(2-acetyl-4,5-dimethoxyanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(2-acetyl-4,5-dimethoxyanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 1390446 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (E)-3-(2-acetyl-4,5-dimethoxyanilino)-2-(4-phenyl-1,3-thiazol-2-yl)prop-2-enenitrile |
| SMILES | COc1cc(N/C=C(\C#N)c2nc(-c3ccccc3)cs2)c(C(C)=O)cc1OC |
| InChI | InChI=1S/C22H19N3O3S/c1-14(26)17-9-20(27-2)21(28-3)10-18(17)24-12-16(11-23)22-25-19(13-29-22)15-7-5-4-6-8-15/h4-10,12-13,24H,1-3H3/b16-12+ |
| InChIKey | NYAPQXSQTNWETH-FOWTUZBSSA-N |
| XLogP | 5.01 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|