C19H11BrF3N3S — CID 2870698
(Z)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)anilino]prop-2-enenitrile (PubChem CID 2870698) has the molecular formula C19H11BrF3N3S and a molecular weight of 450.28 g/mol. Its IUPAC name is (Z)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)anilino]prop-2-enenitrile.
| Compound Name | (Z)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)anilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 2870698 |
| Molecular Formula | C19H11BrF3N3S |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 448.98 |
| IUPAC Name | (Z)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)anilino]prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1cccc(C(F)(F)F)c1)c1nc(-c2cccc(Br)c2)cs1 |
| InChI | InChI=1S/C19H11BrF3N3S/c20-15-5-1-3-12(7-15)17-11-27-18(26-17)13(9-24)10-25-16-6-2-4-14(8-16)19(21,22)23/h1-8,10-11,25H/b13-10- |
| InChIKey | RVTSSSANYKDDDQ-RAXLEYEMSA-N |
| XLogP | 6.57 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|