C17H11BrN2S2 — CID 5345070
(E)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enenitrile (PubChem CID 5345070) has the molecular formula C17H11BrN2S2 and a molecular weight of 387.33 g/mol. Its IUPAC name is (E)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5345070 |
| Molecular Formula | C17H11BrN2S2 |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | (E)-2-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccsc1/C=C(\C#N)c1nc(-c2cccc(Br)c2)cs1 |
| InChI | InChI=1S/C17H11BrN2S2/c1-11-5-6-21-16(11)8-13(9-19)17-20-15(10-22-17)12-3-2-4-14(18)7-12/h2-8,10H,1H3/b13-8+ |
| InChIKey | RDQQDEXSRGETAX-MDWZMJQESA-N |
| XLogP | 6.01 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|