C21H20N4S — CID 3304755
N-(2,4-dimethylanilino)-4-(2,4-dimethylphenyl)-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 3304755) has the molecular formula C21H20N4S and a molecular weight of 360.49 g/mol. Its IUPAC name is N-(2,4-dimethylanilino)-4-(2,4-dimethylphenyl)-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | N-(2,4-dimethylanilino)-4-(2,4-dimethylphenyl)-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 3304755 |
| Molecular Formula | C21H20N4S |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-(2,4-dimethylanilino)-4-(2,4-dimethylphenyl)-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | Cc1ccc(NN=C(C#N)c2nc(-c3ccc(C)cc3C)cs2)c(C)c1 |
| InChI | InChI=1S/C21H20N4S/c1-13-5-7-17(15(3)9-13)20-12-26-21(23-20)19(11-22)25-24-18-8-6-14(2)10-16(18)4/h5-10,12,24H,1-4H3 |
| InChIKey | NLUGIOUPORJDTC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|