C22H22N4S — CID 6373641
(2E)-4-(4-ethylphenyl)-N-(2,4,6-trimethylanilino)-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 6373641) has the molecular formula C22H22N4S and a molecular weight of 374.51 g/mol. Its IUPAC name is (2E)-4-(4-ethylphenyl)-N-(2,4,6-trimethylanilino)-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | (2E)-4-(4-ethylphenyl)-N-(2,4,6-trimethylanilino)-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 6373641 |
| Molecular Formula | C22H22N4S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (2E)-4-(4-ethylphenyl)-N-(2,4,6-trimethylanilino)-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | CCc1ccc(-c2csc(/C(C#N)=N/Nc3c(C)cc(C)cc3C)n2)cc1 |
| InChI | InChI=1S/C22H22N4S/c1-5-17-6-8-18(9-7-17)20-13-27-22(24-20)19(12-23)25-26-21-15(3)10-14(2)11-16(21)4/h6-11,13,26H,5H2,1-4H3/b25-19+ |
| InChIKey | QLLGNAFZFYQTNM-NCELDCMTSA-N |
| XLogP | 5.64 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|