C20H18N4OS — CID 3730657
N-(4-ethylanilino)-4-(4-methoxyphenyl)-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 3730657) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is N-(4-ethylanilino)-4-(4-methoxyphenyl)-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | N-(4-ethylanilino)-4-(4-methoxyphenyl)-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 3730657 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-(4-ethylanilino)-4-(4-methoxyphenyl)-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | CCc1ccc(NN=C(C#N)c2nc(-c3ccc(OC)cc3)cs2)cc1 |
| InChI | InChI=1S/C20H18N4OS/c1-3-14-4-8-16(9-5-14)23-24-18(12-21)20-22-19(13-26-20)15-6-10-17(25-2)11-7-15/h4-11,13,23H,3H2,1-2H3 |
| InChIKey | LXMWCKKMWRTRNL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|