C18H13BrN4OS — CID 3634746
N-(4-bromoanilino)-4-(3-methoxyphenyl)-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 3634746) has the molecular formula C18H13BrN4OS and a molecular weight of 413.30 g/mol. Its IUPAC name is N-(4-bromoanilino)-4-(3-methoxyphenyl)-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | N-(4-bromoanilino)-4-(3-methoxyphenyl)-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 3634746 |
| Molecular Formula | C18H13BrN4OS |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | N-(4-bromoanilino)-4-(3-methoxyphenyl)-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | COc1cccc(-c2csc(C(C#N)=NNc3ccc(Br)cc3)n2)c1 |
| InChI | InChI=1S/C18H13BrN4OS/c1-24-15-4-2-3-12(9-15)17-11-25-18(21-17)16(10-20)23-22-14-7-5-13(19)6-8-14/h2-9,11,22H,1H3 |
| InChIKey | JVQZDUNSSVMRFK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|