C17H10ClN5O2S — CID 3753846
N-(4-chloroanilino)-4-(3-nitrophenyl)-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 3753846) has the molecular formula C17H10ClN5O2S and a molecular weight of 383.82 g/mol. Its IUPAC name is N-(4-chloroanilino)-4-(3-nitrophenyl)-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | N-(4-chloroanilino)-4-(3-nitrophenyl)-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 3753846 |
| Molecular Formula | C17H10ClN5O2S |
| Molecular Weight | 383.82 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | N-(4-chloroanilino)-4-(3-nitrophenyl)-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | N#CC(=NNc1ccc(Cl)cc1)c1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C17H10ClN5O2S/c18-12-4-6-13(7-5-12)21-22-15(9-19)17-20-16(10-26-17)11-2-1-3-14(8-11)23(24)25/h1-8,10,21H |
| InChIKey | SZZYSWRGWACZLI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.82 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|