C18H9ClF3N5O2S — CID 41056993
(2Z)-N-[2-chloro-5-(trifluoromethyl)anilino]-4-(3-nitrophenyl)-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 41056993) has the molecular formula C18H9ClF3N5O2S and a molecular weight of 451.82 g/mol. Its IUPAC name is (2Z)-N-[2-chloro-5-(trifluoromethyl)anilino]-4-(3-nitrophenyl)-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | (2Z)-N-[2-chloro-5-(trifluoromethyl)anilino]-4-(3-nitrophenyl)-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 41056993 |
| Molecular Formula | C18H9ClF3N5O2S |
| Molecular Weight | 451.82 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | (2Z)-N-[2-chloro-5-(trifluoromethyl)anilino]-4-(3-nitrophenyl)-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | N#C/C(=N/Nc1cc(C(F)(F)F)ccc1Cl)c1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C18H9ClF3N5O2S/c19-13-5-4-11(18(20,21)22)7-14(13)25-26-15(8-23)17-24-16(9-30-17)10-2-1-3-12(6-10)27(28)29/h1-7,9,25H/b26-15- |
| InChIKey | WVUFFBUSDFAKRG-YSMPRRRNSA-N |
| XLogP | 5.73 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.82 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|