C17H10Cl2N4S — CID 6534550
(2Z)-N-(2,4-dichloroanilino)-4-phenyl-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 6534550) has the molecular formula C17H10Cl2N4S and a molecular weight of 373.27 g/mol. Its IUPAC name is (2Z)-N-(2,4-dichloroanilino)-4-phenyl-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | (2Z)-N-(2,4-dichloroanilino)-4-phenyl-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 6534550 |
| Molecular Formula | C17H10Cl2N4S |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | (2Z)-N-(2,4-dichloroanilino)-4-phenyl-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | N#C/C(=N/Nc1ccc(Cl)cc1Cl)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H10Cl2N4S/c18-12-6-7-14(13(19)8-12)22-23-15(9-20)17-21-16(10-24-17)11-4-2-1-3-5-11/h1-8,10,22H/b23-15- |
| InChIKey | RYWXHNIDRPYMFF-HAHDFKILSA-N |
| XLogP | 5.46 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|