C17H9Cl3N4S — CID 2753911
4-(4-chlorophenyl)-N-(2,4-dichloroanilino)-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 2753911) has the molecular formula C17H9Cl3N4S and a molecular weight of 407.71 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(2,4-dichloroanilino)-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | 4-(4-chlorophenyl)-N-(2,4-dichloroanilino)-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 2753911 |
| Molecular Formula | C17H9Cl3N4S |
| Molecular Weight | 407.71 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(2,4-dichloroanilino)-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | N#CC(=NNc1ccc(Cl)cc1Cl)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C17H9Cl3N4S/c18-11-3-1-10(2-4-11)16-9-25-17(22-16)15(8-21)24-23-14-6-5-12(19)7-13(14)20/h1-7,9,23H |
| InChIKey | RXCYKJMORDSJLD-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.71 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|