C17H10ClFN4S — CID 6257271
(2E)-4-(4-chlorophenyl)-N-(2-fluoroanilino)-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 6257271) has the molecular formula C17H10ClFN4S and a molecular weight of 356.81 g/mol. Its IUPAC name is (2E)-4-(4-chlorophenyl)-N-(2-fluoroanilino)-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | (2E)-4-(4-chlorophenyl)-N-(2-fluoroanilino)-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 6257271 |
| Molecular Formula | C17H10ClFN4S |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | (2E)-4-(4-chlorophenyl)-N-(2-fluoroanilino)-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | N#C/C(=N\Nc1ccccc1F)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C17H10ClFN4S/c18-12-7-5-11(6-8-12)16-10-24-17(21-16)15(9-20)23-22-14-4-2-1-3-13(14)19/h1-8,10,22H/b23-15+ |
| InChIKey | ZZNNPTCDPKJHDF-HZHRSRAPSA-N |
| XLogP | 4.94 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|