C11H7FN4OS — CID 4737678
N-(2-fluoroanilino)-4-hydroxy-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 4737678) has the molecular formula C11H7FN4OS and a molecular weight of 262.27 g/mol. Its IUPAC name is N-(2-fluoroanilino)-4-hydroxy-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | N-(2-fluoroanilino)-4-hydroxy-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 4737678 |
| Molecular Formula | C11H7FN4OS |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | N-(2-fluoroanilino)-4-hydroxy-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | N#CC(=NNc1ccccc1F)c1nc(O)cs1 |
| InChI | InChI=1S/C11H7FN4OS/c12-7-3-1-2-4-8(7)15-16-9(5-13)11-14-10(17)6-18-11/h1-4,6,15,17H |
| InChIKey | KBLFXFUGXFGYJQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|