C17H10Cl2N6OS — CID 135868193
(2Z)-N-(2-chloroanilino)-5-[(2-chlorophenyl)diazenyl]-4-hydroxy-1,3-thiazole-2-carboximidoyl cyanide (PubChem CID 135868193) has the molecular formula C17H10Cl2N6OS and a molecular weight of 417.28 g/mol. Its IUPAC name is (2Z)-N-(2-chloroanilino)-5-[(2-chlorophenyl)diazenyl]-4-hydroxy-1,3-thiazole-2-carboximidoyl cyanide.
| Compound Name | (2Z)-N-(2-chloroanilino)-5-[(2-chlorophenyl)diazenyl]-4-hydroxy-1,3-thiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 135868193 |
| Molecular Formula | C17H10Cl2N6OS |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | (2Z)-N-(2-chloroanilino)-5-[(2-chlorophenyl)diazenyl]-4-hydroxy-1,3-thiazole-2-carboximidoyl cyanide |
| SMILES | N#C/C(=N/Nc1ccccc1Cl)c1nc(O)c(/N=N/c2ccccc2Cl)s1 |
| InChI | InChI=1S/C17H10Cl2N6OS/c18-10-5-1-3-7-12(10)22-24-14(9-20)16-21-15(26)17(27-16)25-23-13-8-4-2-6-11(13)19/h1-8,22,26H/b24-14-,25-23+ |
| InChIKey | JVIGBCYUZRRTCO-MRLSLNGVSA-N |
| XLogP | 5.91 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|