C15H10N4OS — CID 136676135
(2Z)-N-(4-hydroxyanilino)-1,3-benzothiazole-2-carboximidoyl cyanide (PubChem CID 136676135) has the molecular formula C15H10N4OS and a molecular weight of 294.34 g/mol. Its IUPAC name is (2Z)-N-(4-hydroxyanilino)-1,3-benzothiazole-2-carboximidoyl cyanide.
| Compound Name | (2Z)-N-(4-hydroxyanilino)-1,3-benzothiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 136676135 |
| Molecular Formula | C15H10N4OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (2Z)-N-(4-hydroxyanilino)-1,3-benzothiazole-2-carboximidoyl cyanide |
| SMILES | N#C/C(=N/Nc1ccc(O)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H10N4OS/c16-9-13(19-18-10-5-7-11(20)8-6-10)15-17-12-3-1-2-4-14(12)21-15/h1-8,18,20H/b19-13- |
| InChIKey | BWOWBHQQAGTALZ-UYRXBGFRSA-N |
| XLogP | 3.34 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|