C19H19N5O2S2 — CID 4190748
N-[3-(diethylsulfamoyl)anilino]-1,3-benzothiazole-2-carboximidoyl cyanide (PubChem CID 4190748) has the molecular formula C19H19N5O2S2 and a molecular weight of 413.53 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)anilino]-1,3-benzothiazole-2-carboximidoyl cyanide.
| Compound Name | N-[3-(diethylsulfamoyl)anilino]-1,3-benzothiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 4190748 |
| Molecular Formula | C19H19N5O2S2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-[3-(diethylsulfamoyl)anilino]-1,3-benzothiazole-2-carboximidoyl cyanide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NN=C(C#N)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C19H19N5O2S2/c1-3-24(4-2)28(25,26)15-9-7-8-14(12-15)22-23-17(13-20)19-21-16-10-5-6-11-18(16)27-19/h5-12,22H,3-4H2,1-2H3 |
| InChIKey | WPOXZUYLSTUYLE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|