C16H9N5S — CID 8007555
(2Z)-N-(4-cyanoanilino)-1,3-benzothiazole-2-carboximidoyl cyanide (PubChem CID 8007555) has the molecular formula C16H9N5S and a molecular weight of 303.35 g/mol. Its IUPAC name is (2Z)-N-(4-cyanoanilino)-1,3-benzothiazole-2-carboximidoyl cyanide.
| Compound Name | (2Z)-N-(4-cyanoanilino)-1,3-benzothiazole-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 8007555 |
| Molecular Formula | C16H9N5S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (2Z)-N-(4-cyanoanilino)-1,3-benzothiazole-2-carboximidoyl cyanide |
| SMILES | N#C/C(=N/Nc1ccc(C#N)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H9N5S/c17-9-11-5-7-12(8-6-11)20-21-14(10-18)16-19-13-3-1-2-4-15(13)22-16/h1-8,20H/b21-14- |
| InChIKey | FIXYJQTXVRRUHG-STZFKDTASA-N |
| XLogP | 3.51 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|