C9H5AgN3OS — CID 3496082
2-(1,3-benzothiazol-2-yl)-2-hydroxyiminoacetonitrile;silver (PubChem CID 3496082) has the molecular formula C9H5AgN3OS and a molecular weight of 311.09 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-2-hydroxyiminoacetonitrile;silver.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-2-hydroxyiminoacetonitrile;silver |
|---|---|
| PubChem CID | 3496082 |
| Molecular Formula | C9H5AgN3OS |
| Molecular Weight | 311.09 g/mol |
| Exact Mass | 309.92 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-2-hydroxyiminoacetonitrile;silver |
| SMILES | N#CC(=NO)c1nc2ccccc2s1.[Ag] |
| InChI | InChI=1S/C9H5N3OS.Ag/c10-5-7(12-13)9-11-6-3-1-2-4-8(6)14-9;/h1-4,13H; |
| InChIKey | PSYMGAJGNFCHMJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.09 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|