C8H5ClN2OS — CID 137226109
N-hydroxy-1,3-benzothiazole-2-carboximidoyl chloride (PubChem CID 137226109) has the molecular formula C8H5ClN2OS and a molecular weight of 212.66 g/mol. Its IUPAC name is N-hydroxy-1,3-benzothiazole-2-carboximidoyl chloride.
| Compound Name | N-hydroxy-1,3-benzothiazole-2-carboximidoyl chloride |
|---|---|
| PubChem CID | 137226109 |
| Molecular Formula | C8H5ClN2OS |
| Molecular Weight | 212.66 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | N-hydroxy-1,3-benzothiazole-2-carboximidoyl chloride |
| SMILES | ON=C(Cl)c1nc2ccccc2s1 |
| InChI | InChI=1S/C8H5ClN2OS/c9-7(11-12)8-10-5-3-1-2-4-6(5)13-8/h1-4,12H |
| InChIKey | COUPOINFIWABMU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.66 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|