C11H11N3OS — CID 59268188
(Z)-3-amino-2-(1,3-benzothiazol-2-yl)but-2-enamide (PubChem CID 59268188) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is (Z)-3-amino-2-(1,3-benzothiazol-2-yl)but-2-enamide.
| Compound Name | (Z)-3-amino-2-(1,3-benzothiazol-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 59268188 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | (Z)-3-amino-2-(1,3-benzothiazol-2-yl)but-2-enamide |
| SMILES | C/C(N)=C(\C(N)=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C11H11N3OS/c1-6(12)9(10(13)15)11-14-7-4-2-3-5-8(7)16-11/h2-5H,12H2,1H3,(H2,13,15)/b9-6- |
| InChIKey | YJGPSAHJWYXTSY-TWGQIWQCSA-N |
| XLogP | 1.47 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|