C13H11N3O3S — CID 166628427
ethyl 2-[(E)-[1,3-benzothiazol-2-yl(cyano)methylidene]amino]oxyacetate (PubChem CID 166628427) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is ethyl 2-[(E)-[1,3-benzothiazol-2-yl(cyano)methylidene]amino]oxyacetate.
| Compound Name | ethyl 2-[(E)-[1,3-benzothiazol-2-yl(cyano)methylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 166628427 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | ethyl 2-[(E)-[1,3-benzothiazol-2-yl(cyano)methylidene]amino]oxyacetate |
| SMILES | CCOC(=O)CO/N=C(\C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H11N3O3S/c1-2-18-12(17)8-19-16-10(7-14)13-15-9-5-3-4-6-11(9)20-13/h3-6H,2,8H2,1H3/b16-10+ |
| InChIKey | WGGHKCUFOUCLLI-MHWRWJLKSA-N |
| XLogP | 2.10 |
| TPSA | 84.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|