C13H15N3O2S — CID 71353880
ethyl 3-(1,3-benzothiazol-2-ylhydrazinylidene)butanoate (PubChem CID 71353880) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is ethyl 3-(1,3-benzothiazol-2-ylhydrazinylidene)butanoate.
| Compound Name | ethyl 3-(1,3-benzothiazol-2-ylhydrazinylidene)butanoate |
|---|---|
| PubChem CID | 71353880 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | ethyl 3-(1,3-benzothiazol-2-ylhydrazinylidene)butanoate |
| SMILES | CCOC(=O)CC(C)=NNc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H15N3O2S/c1-3-18-12(17)8-9(2)15-16-13-14-10-6-4-5-7-11(10)19-13/h4-7H,3,8H2,1-2H3,(H,14,16) |
| InChIKey | SFFCBVRQEAXFDB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|