C15H14N4S — CID 162655441
N-[(E)-1-(2-aminophenyl)ethylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 162655441) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is N-[(E)-1-(2-aminophenyl)ethylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(E)-1-(2-aminophenyl)ethylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 162655441 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-[(E)-1-(2-aminophenyl)ethylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | C/C(=N\Nc1nc2ccccc2s1)c1ccccc1N |
| InChI | InChI=1S/C15H14N4S/c1-10(11-6-2-3-7-12(11)16)18-19-15-17-13-8-4-5-9-14(13)20-15/h2-9H,16H2,1H3,(H,17,19)/b18-10+ |
| InChIKey | AVHMHSPGSXLJOJ-VCHYOVAHSA-N |
| XLogP | 3.71 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|