C15H11F2N3S — CID 9017093
N-[(Z)-1-(2,5-difluorophenyl)ethylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 9017093) has the molecular formula C15H11F2N3S and a molecular weight of 303.34 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-difluorophenyl)ethylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-1-(2,5-difluorophenyl)ethylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 9017093 |
| Molecular Formula | C15H11F2N3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-[(Z)-1-(2,5-difluorophenyl)ethylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | C/C(=N/Nc1nc2ccccc2s1)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H11F2N3S/c1-9(11-8-10(16)6-7-12(11)17)19-20-15-18-13-4-2-3-5-14(13)21-15/h2-8H,1H3,(H,18,20)/b19-9- |
| InChIKey | IRLLTWSPPKVPBJ-OCKHKDLRSA-N |
| XLogP | 4.41 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|