C14H9FN2OS2 — CID 107021686
N-(1,3-benzothiazol-2-yl)-2-fluoro-5-sulfanylbenzamide (PubChem CID 107021686) has the molecular formula C14H9FN2OS2 and a molecular weight of 304.37 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-fluoro-5-sulfanylbenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-fluoro-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107021686 |
| Molecular Formula | C14H9FN2OS2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-fluoro-5-sulfanylbenzamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1cc(S)ccc1F |
| InChI | InChI=1S/C14H9FN2OS2/c15-10-6-5-8(19)7-9(10)13(18)17-14-16-11-3-1-2-4-12(11)20-14/h1-7,19H,(H,16,17,18) |
| InChIKey | ZSKLXIUFJPECNA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|