C12H8N2OS3 — CID 107021690
N-(1,3-benzothiazol-2-yl)-4-sulfanylthiophene-2-carboxamide (PubChem CID 107021690) has the molecular formula C12H8N2OS3 and a molecular weight of 292.41 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107021690 |
| Molecular Formula | C12H8N2OS3 |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-sulfanylthiophene-2-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1cc(S)cs1 |
| InChI | InChI=1S/C12H8N2OS3/c15-11(10-5-7(16)6-17-10)14-12-13-8-3-1-2-4-9(8)18-12/h1-6,16H,(H,13,14,15) |
| InChIKey | UDLZJNOZFMCGFK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|