C14H9F2N3OS — CID 79758434
3-amino-N-(1,3-benzothiazol-2-yl)-2,6-difluorobenzamide (PubChem CID 79758434) has the molecular formula C14H9F2N3OS and a molecular weight of 305.31 g/mol. Its IUPAC name is 3-amino-N-(1,3-benzothiazol-2-yl)-2,6-difluorobenzamide.
| Compound Name | 3-amino-N-(1,3-benzothiazol-2-yl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 79758434 |
| Molecular Formula | C14H9F2N3OS |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-amino-N-(1,3-benzothiazol-2-yl)-2,6-difluorobenzamide |
| SMILES | Nc1ccc(F)c(C(=O)Nc2nc3ccccc3s2)c1F |
| InChI | InChI=1S/C14H9F2N3OS/c15-7-5-6-8(17)12(16)11(7)13(20)19-14-18-9-3-1-2-4-10(9)21-14/h1-6H,17H2,(H,18,19,20) |
| InChIKey | UUKBXGVXHUBNLC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|