C13H11N5S — CID 5351439
N-[(E)-1-pyrimidin-4-ylethylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 5351439) has the molecular formula C13H11N5S and a molecular weight of 269.33 g/mol. Its IUPAC name is N-[(E)-1-pyrimidin-4-ylethylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(E)-1-pyrimidin-4-ylethylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 5351439 |
| Molecular Formula | C13H11N5S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N-[(E)-1-pyrimidin-4-ylethylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | C/C(=N\Nc1nc2ccccc2s1)c1ccncn1 |
| InChI | InChI=1S/C13H11N5S/c1-9(10-6-7-14-8-15-10)17-18-13-16-11-4-2-3-5-12(11)19-13/h2-8H,1H3,(H,16,18)/b17-9+ |
| InChIKey | ZMEIUSLAHMLILY-RQZCQDPDSA-N |
| XLogP | 2.92 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|