C13H12N6 — CID 5470579
N-[(Z)-1-pyrimidin-4-ylethylideneamino]-1H-benzimidazol-2-amine (PubChem CID 5470579) has the molecular formula C13H12N6 and a molecular weight of 252.28 g/mol. Its IUPAC name is N-[(Z)-1-pyrimidin-4-ylethylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[(Z)-1-pyrimidin-4-ylethylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 5470579 |
| Molecular Formula | C13H12N6 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-[(Z)-1-pyrimidin-4-ylethylideneamino]-1H-benzimidazol-2-amine |
| SMILES | C/C(=N/Nc1nc2ccccc2[nH]1)c1ccncn1 |
| InChI | InChI=1S/C13H12N6/c1-9(10-6-7-14-8-15-10)18-19-13-16-11-4-2-3-5-12(11)17-13/h2-8H,1H3,(H2,16,17,19)/b18-9- |
| InChIKey | GSVZQYFWGJGZGV-NVMNQCDNSA-N |
| XLogP | 2.19 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|