C15H12F2N4 — CID 3966393
N-[1-(2,6-difluorophenyl)ethylideneamino]-1H-benzimidazol-2-amine (PubChem CID 3966393) has the molecular formula C15H12F2N4 and a molecular weight of 286.29 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)ethylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[1-(2,6-difluorophenyl)ethylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 3966393 |
| Molecular Formula | C15H12F2N4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)ethylideneamino]-1H-benzimidazol-2-amine |
| SMILES | CC(=NNc1nc2ccccc2[nH]1)c1c(F)cccc1F |
| InChI | InChI=1S/C15H12F2N4/c1-9(14-10(16)5-4-6-11(14)17)20-21-15-18-12-7-2-3-8-13(12)19-15/h2-8H,1H3,(H2,18,19,21) |
| InChIKey | RADOJCZTRRPZLN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|