C17H16F2N4O — CID 6529655
N-[(Z)-1-[4-(difluoromethoxy)phenyl]propylideneamino]-1H-benzimidazol-2-amine (PubChem CID 6529655) has the molecular formula C17H16F2N4O and a molecular weight of 330.34 g/mol. Its IUPAC name is N-[(Z)-1-[4-(difluoromethoxy)phenyl]propylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[(Z)-1-[4-(difluoromethoxy)phenyl]propylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 6529655 |
| Molecular Formula | C17H16F2N4O |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-[(Z)-1-[4-(difluoromethoxy)phenyl]propylideneamino]-1H-benzimidazol-2-amine |
| SMILES | CC/C(=N/Nc1nc2ccccc2[nH]1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H16F2N4O/c1-2-13(11-7-9-12(10-8-11)24-16(18)19)22-23-17-20-14-5-3-4-6-15(14)21-17/h3-10,16H,2H2,1H3,(H2,20,21,23)/b22-13- |
| InChIKey | PCCCWEHLEPVNQB-XKZIYDEJSA-N |
| XLogP | 4.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|