C19H20N4O5 — CID 73242970
N-[1-(4-methoxyphenyl)propan-2-ylideneamino]-1H-benzimidazol-2-amine;oxalic acid (PubChem CID 73242970) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)propan-2-ylideneamino]-1H-benzimidazol-2-amine;oxalic acid.
| Compound Name | N-[1-(4-methoxyphenyl)propan-2-ylideneamino]-1H-benzimidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 73242970 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[1-(4-methoxyphenyl)propan-2-ylideneamino]-1H-benzimidazol-2-amine;oxalic acid |
| SMILES | COc1ccc(CC(C)=NNc2nc3ccccc3[nH]2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H18N4O.C2H2O4/c1-12(11-13-7-9-14(22-2)10-8-13)20-21-17-18-15-5-3-4-6-16(15)19-17;3-1(4)2(5)6/h3-10H,11H2,1-2H3,(H2,18,19,21);(H,3,4)(H,5,6) |
| InChIKey | UWDNWUVHTXFACW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|