C17H18N4O2 — CID 7912538
N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-1H-benzimidazol-2-amine (PubChem CID 7912538) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 7912538 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-1H-benzimidazol-2-amine |
| SMILES | COc1ccc(/C(C)=N\Nc2nc3ccccc3[nH]2)c(OC)c1 |
| InChI | InChI=1S/C17H18N4O2/c1-11(13-9-8-12(22-2)10-16(13)23-3)20-21-17-18-14-6-4-5-7-15(14)19-17/h4-10H,1-3H3,(H2,18,19,21)/b20-11- |
| InChIKey | PKAOIYPZUUSFBB-JAIQZWGSSA-N |
| XLogP | 3.42 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|