C15H18N4O3 — CID 135475039
2-[2-[1-(2,5-dimethoxyphenyl)ethylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 135475039) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-[2-[1-(2,5-dimethoxyphenyl)ethylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-[1-(2,5-dimethoxyphenyl)ethylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135475039 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-[2-[1-(2,5-dimethoxyphenyl)ethylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | COc1ccc(OC)c(C(C)=NNc2nc(C)cc(=O)[nH]2)c1 |
| InChI | InChI=1S/C15H18N4O3/c1-9-7-14(20)17-15(16-9)19-18-10(2)12-8-11(21-3)5-6-13(12)22-4/h5-8H,1-4H3,(H2,16,17,19,20) |
| InChIKey | VCMIQNPONKXMEN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|