C19H17F3N4O2 — CID 8982089
N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 8982089) has the molecular formula C19H17F3N4O2 and a molecular weight of 390.37 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 8982089 |
| Molecular Formula | C19H17F3N4O2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | COc1ccc(/C(C)=N\Nc2nc(C(F)(F)F)nc3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C19H17F3N4O2/c1-11(13-9-8-12(27-2)10-16(13)28-3)25-26-17-14-6-4-5-7-15(14)23-18(24-17)19(20,21)22/h4-10H,1-3H3,(H,23,24,26)/b25-11- |
| InChIKey | GKBXAWOFMRQWJO-GATIEOLUSA-N |
| XLogP | 4.50 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|