C15H13F3N6S — CID 9396989
3-methyl-4-[(Z)-C-methyl-N-[[2-(trifluoromethyl)quinazolin-4-yl]amino]carbonimidoyl]-1,2-thiazol-5-amine (PubChem CID 9396989) has the molecular formula C15H13F3N6S and a molecular weight of 366.37 g/mol. Its IUPAC name is 3-methyl-4-[(Z)-C-methyl-N-[[2-(trifluoromethyl)quinazolin-4-yl]amino]carbonimidoyl]-1,2-thiazol-5-amine.
| Compound Name | 3-methyl-4-[(Z)-C-methyl-N-[[2-(trifluoromethyl)quinazolin-4-yl]amino]carbonimidoyl]-1,2-thiazol-5-amine |
|---|---|
| PubChem CID | 9396989 |
| Molecular Formula | C15H13F3N6S |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 3-methyl-4-[(Z)-C-methyl-N-[[2-(trifluoromethyl)quinazolin-4-yl]amino]carbonimidoyl]-1,2-thiazol-5-amine |
| SMILES | C/C(=N/Nc1nc(C(F)(F)F)nc2ccccc12)c1c(C)nsc1N |
| InChI | InChI=1S/C15H13F3N6S/c1-7(11-8(2)24-25-12(11)19)22-23-13-9-5-3-4-6-10(9)20-14(21-13)15(16,17)18/h3-6H,19H2,1-2H3,(H,20,21,23)/b22-7- |
| InChIKey | QTBVSKRNHKSFSL-HOEBFWFUSA-N |
| XLogP | 3.83 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|