C14H16F3N3O2 — CID 110433067
2-[[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]-2-methylpropan-1-ol (PubChem CID 110433067) has the molecular formula C14H16F3N3O2 and a molecular weight of 315.30 g/mol. Its IUPAC name is 2-[[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]-2-methylpropan-1-ol.
| Compound Name | 2-[[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 110433067 |
| Molecular Formula | C14H16F3N3O2 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-[[7-methoxy-2-(trifluoromethyl)quinazolin-4-yl]amino]-2-methylpropan-1-ol |
| SMILES | COc1ccc2c(NC(C)(C)CO)nc(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C14H16F3N3O2/c1-13(2,7-21)20-11-9-5-4-8(22-3)6-10(9)18-12(19-11)14(15,16)17/h4-6,21H,7H2,1-3H3,(H,18,19,20) |
| InChIKey | QSICDEMKGQIWTG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |