C17H11F6N3O — CID 7719355
7-methoxy-2-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]quinazolin-4-amine (PubChem CID 7719355) has the molecular formula C17H11F6N3O and a molecular weight of 387.28 g/mol. Its IUPAC name is 7-methoxy-2-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]quinazolin-4-amine.
| Compound Name | 7-methoxy-2-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 7719355 |
| Molecular Formula | C17H11F6N3O |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 7-methoxy-2-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]quinazolin-4-amine |
| SMILES | COc1ccc2c(Nc3cccc(C(F)(F)F)c3)nc(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C17H11F6N3O/c1-27-11-5-6-12-13(8-11)25-15(17(21,22)23)26-14(12)24-10-4-2-3-9(7-10)16(18,19)20/h2-8H,1H3,(H,24,25,26) |
| InChIKey | LODWSEXGWRQDMT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |