C14H16F3N3O — CID 110431380
N-butyl-7-methoxy-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 110431380) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is N-butyl-7-methoxy-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | N-butyl-7-methoxy-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 110431380 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-butyl-7-methoxy-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | CCCCNc1nc(C(F)(F)F)nc2cc(OC)ccc12 |
| InChI | InChI=1S/C14H16F3N3O/c1-3-4-7-18-12-10-6-5-9(21-2)8-11(10)19-13(20-12)14(15,16)17/h5-6,8H,3-4,7H2,1-2H3,(H,18,19,20) |
| InChIKey | YWEGEQNWPUOVPS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|